C34H47N5O6 — CID 155995795
2,16-bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-oxa-2,16,20-triazatricyclo[16.3.1.03,8]docosa-1(21),3,5,7,18(22),19-hexaen-17-one (PubChem CID 155995795) has the molecular formula C34H47N5O6 and a molecular weight of 621.78 g/mol. Its IUPAC name is 2,16-bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-oxa-2,16,20-triazatricyclo[16.3.1.03,8]docosa-1(21),3,5,7,18(22),19-hexaen-17-one.
| Compound Name | 2,16-bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-oxa-2,16,20-triazatricyclo[16.3.1.03,8]docosa-1(21),3,5,7,18(22),19-hexaen-17-one |
|---|---|
| PubChem CID | 155995795 |
| Molecular Formula | C34H47N5O6 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.35 |
| IUPAC Name | 2,16-bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-9-oxa-2,16,20-triazatricyclo[16.3.1.03,8]docosa-1(21),3,5,7,18(22),19-hexaen-17-one |
| SMILES | CC1CN(C(=O)CN2CCCCCCOc3ccccc3N(CC(=O)N3CC(C)OC(C)C3)c3cncc(c3)C2=O)CC(C)O1 |
| InChI | InChI=1S/C34H47N5O6/c1-24-18-37(19-25(2)44-24)32(40)22-36-13-9-5-6-10-14-43-31-12-8-7-11-30(31)39(29-15-28(34(36)42)16-35-17-29)23-33(41)38-20-26(3)45-27(4)21-38/h7-8,11-12,15-17,24-27H,5-6,9-10,13-14,18-23H2,1-4H3 |
| InChIKey | PILIGAOYKQXNCU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |