C20H30N2O3 — CID 155996016
N-[[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]methyl]-2-piperidin-4-ylacetamide (PubChem CID 155996016) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]methyl]-2-piperidin-4-ylacetamide.
| Compound Name | N-[[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]methyl]-2-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 155996016 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]methyl]-2-piperidin-4-ylacetamide |
| SMILES | O=C(CC1CCNCC1)NC[C@H]1CCC[C@@H](Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C20H30N2O3/c23-19(13-15-9-11-21-12-10-15)22-14-16-5-4-8-18(20(16)24)25-17-6-2-1-3-7-17/h1-3,6-7,15-16,18,20-21,24H,4-5,8-14H2,(H,22,23)/t16-,18-,20-/m1/s1 |
| InChIKey | MHFWJYBXSFKPMB-YVWKXTFCSA-N |
| XLogP | 2.10 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |