C27H49N5O6 — CID 155997454
1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[3-(2-methylimidazol-1-yl)propylamino]ethanone (PubChem CID 155997454) has the molecular formula C27H49N5O6 and a molecular weight of 539.72 g/mol. Its IUPAC name is 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[3-(2-methylimidazol-1-yl)propylamino]ethanone.
| Compound Name | 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[3-(2-methylimidazol-1-yl)propylamino]ethanone |
|---|---|
| PubChem CID | 155997454 |
| Molecular Formula | C27H49N5O6 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[3-(2-methylimidazol-1-yl)propylamino]ethanone |
| SMILES | CO[C@@H]1CN(C(C)=O)C[C@@H](CC(C)C)N(C(=O)CNCCCn2ccnc2C)CCCCOC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H49N5O6/c1-20(2)15-23-17-31(22(4)33)18-25(37-5)27(36)24(34)19-38-14-7-6-12-32(23)26(35)16-28-9-8-11-30-13-10-29-21(30)3/h10,13,20,23-25,27-28,34,36H,6-9,11-12,14-19H2,1-5H3/t23-,24-,25-,27-/m1/s1 |
| InChIKey | MJBDKELNXMQZFQ-DLGLWYJGSA-N |
| XLogP | 0.81 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|