About [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate
[(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate (PubChem CID 155997900) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate.
Molecular Properties
| Compound Name | [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate |
| PubChem CID | 155997900 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate |
| SMILES | Cn1ccnc1CN1C[C@H](CC(N)=O)[C@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-21-8-7-20-17(21)12-22-10-14(9-16(19)23)15(11-22)25-18(24)13-5-3-2-4-6-13/h2-8,14-15H,9-12H2,1H3,(H2,19,23)/t14-,15+/m0/s1 |
| InChIKey | NACDOMHVGZYRMM-LSDHHAIUSA-N |
| XLogP | 0.95 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate?
The IUPAC name of [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate (CID 155997900) is [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate.
What is the SMILES notation for [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate?
The canonical SMILES for [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate is Cn1ccnc1CN1C[C@H](CC(N)=O)[C@H](OC(=O)c2ccccc2)C1.
What is the InChIKey of [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate?
The InChIKey is NACDOMHVGZYRMM-LSDHHAIUSA-N. The full InChI is InChI=1S/C18H22N4O3/c1-21-8-7-20-17(21)12-22-10-14(9-16(19)23)15(11-22)25-18(24)13-5-3-2-4-6-13/h2-8,14-15H,9-12H2,1H3,(H2,19,23)/t14-,15+/m0/s1.
What are the key properties of [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate?
[(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate has a molecular weight of 342.40 g/mol, XLogP of 0.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-(2-amino-2-oxoethyl)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl] benzoate is sourced from PubChem (CID 155997900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).