C26H44N2O6 — CID 155998242
1-[(3E,11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-[3-(5-methylfuran-2-yl)propyl]-1-oxa-6,9-diazacyclotetradec-3-en-9-yl]ethanone (PubChem CID 155998242) has the molecular formula C26H44N2O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is 1-[(3E,11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-[3-(5-methylfuran-2-yl)propyl]-1-oxa-6,9-diazacyclotetradec-3-en-9-yl]ethanone.
| Compound Name | 1-[(3E,11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-[3-(5-methylfuran-2-yl)propyl]-1-oxa-6,9-diazacyclotetradec-3-en-9-yl]ethanone |
|---|---|
| PubChem CID | 155998242 |
| Molecular Formula | C26H44N2O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 1-[(3E,11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-[3-(5-methylfuran-2-yl)propyl]-1-oxa-6,9-diazacyclotetradec-3-en-9-yl]ethanone |
| SMILES | CC(=O)N1CCN(CCCc2ccc(C)o2)C/C=C/COC[C@@H](O)[C@@H](O)[C@H](OCCC(C)C)C1 |
| InChI | InChI=1S/C26H44N2O6/c1-20(2)11-17-33-25-18-28(22(4)29)15-14-27(13-7-8-23-10-9-21(3)34-23)12-5-6-16-32-19-24(30)26(25)31/h5-6,9-10,20,24-26,30-31H,7-8,11-19H2,1-4H3/b6-5+/t24-,25-,26-/m1/s1 |
| InChIKey | JDGMIMDVGPEDNY-CBEREVPUSA-N |
| XLogP | 2.41 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|