C22H28FN3O2 — CID 155999364
[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 155999364) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 155999364 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | CCc1noc(C)c1C(=O)N1CC[C@H]2[C@@H](C1)CC(C)(C)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3O2/c1-5-18-20(14(2)28-24-18)21(27)25-11-10-19-15(13-25)12-22(3,4)26(19)17-8-6-16(23)7-9-17/h6-9,15,19H,5,10-13H2,1-4H3/t15-,19+/m1/s1 |
| InChIKey | LGUPQOZSNZRGNF-BEFAXECRSA-N |
| XLogP | 4.20 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |