C21H21FN2O3 — CID 155999581
8-benzoyl-4-(4-fluorophenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one (PubChem CID 155999581) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 8-benzoyl-4-(4-fluorophenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 8-benzoyl-4-(4-fluorophenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 155999581 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 8-benzoyl-4-(4-fluorophenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C(c1ccccc1)N1CCCC2(C1)CN(c1ccc(F)cc1)C(=O)CO2 |
| InChI | InChI=1S/C21H21FN2O3/c22-17-7-9-18(10-8-17)24-15-21(27-13-19(24)25)11-4-12-23(14-21)20(26)16-5-2-1-3-6-16/h1-3,5-10H,4,11-15H2 |
| InChIKey | OODRMFMQSGAHMA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |