C21H26FN3OS — CID 155999918
[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone (PubChem CID 155999918) has the molecular formula C21H26FN3OS and a molecular weight of 387.52 g/mol. Its IUPAC name is [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 155999918 |
| Molecular Formula | C21H26FN3OS |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CC[C@H]3[C@@H](C2)CC(C)(C)N3c2cccc(F)c2)s1 |
| InChI | InChI=1S/C21H26FN3OS/c1-13-19(27-14(2)23-13)20(26)24-9-8-18-15(12-24)11-21(3,4)25(18)17-7-5-6-16(22)10-17/h5-7,10,15,18H,8-9,11-12H2,1-4H3/t15-,18+/m1/s1 |
| InChIKey | RIMJVKLKPUUOIE-QAPCUYQASA-N |
| XLogP | 4.42 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |