C22H27FN4O — CID 155999940
[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethylpyrimidin-5-yl)methanone (PubChem CID 155999940) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethylpyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 155999940 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
| SMILES | Cc1ncc(C(=O)N2CC[C@H]3[C@@H](C2)CC(C)(C)N3c2cccc(F)c2)c(C)n1 |
| InChI | InChI=1S/C22H27FN4O/c1-14-19(12-24-15(2)25-14)21(28)26-9-8-20-16(13-26)11-22(3,4)27(20)18-7-5-6-17(23)10-18/h5-7,10,12,16,20H,8-9,11,13H2,1-4H3/t16-,20+/m1/s1 |
| InChIKey | GFOQODCTJWRTMH-UZLBHIALSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |