About 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one
7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 15601878) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
Analyze 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The IUPAC name of 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (CID 15601878) is 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
What is the SMILES notation for 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The canonical SMILES for 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one is CC1(C)OCC2C3CC3C(=O)N21.
What is the InChIKey of 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
The InChIKey is VWEAMIQKYZZILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-9(2)10-7(4-12-9)5-3-6(5)8(10)11/h5-7H,3-4H2,1-2H3.
What are the key properties of 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one?
7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one has a molecular weight of 167.21 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one is sourced from PubChem (CID 15601878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).