C31H28F2N4O5 — CID 156019879
4-[[4-[[4-(2,4-Difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 156019879) has the molecular formula C31H28F2N4O5 and a molecular weight of 574.60 g/mol. Its IUPAC name is 4-[[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[[4-(2,4-Difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 156019879 |
| Molecular Formula | C31H28F2N4O5 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 4-[[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCC4=CC=C(C=C4)CN5CCN(CC5)C6=C(C=C(C=C6)F)F |
| InChI | InChI=1S/C31H28F2N4O5/c32-21-8-9-24(23(33)16-21)36-14-12-35(13-15-36)17-19-4-6-20(7-5-19)18-42-26-3-1-2-22-28(26)31(41)37(30(22)40)25-10-11-27(38)34-29(25)39/h1-9,16,25H,10-15,17-18H2,(H,34,38,39) |
| InChIKey | WFFXSERDNVLVGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | 1030 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|