C18H34OSi — CID 15602253
trimethyl-[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxysilane (PubChem CID 15602253) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is trimethyl-[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxysilane.
| Compound Name | trimethyl-[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 15602253 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | trimethyl-[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxysilane |
| SMILES | C=CC(C)(CC/C=C(\C)CCC=C(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-9-18(5,19-20(6,7)8)15-11-14-17(4)13-10-12-16(2)3/h9,12,14H,1,10-11,13,15H2,2-8H3/b17-14+ |
| InChIKey | DHCYATRHOIXBIS-SAPNQHFASA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|