About methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate
methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate (PubChem CID 15603280) has the molecular formula C22H16N4O3
and a molecular weight of 384.40 g/mol. Its IUPAC name is methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate |
| PubChem CID | 15603280 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2nc3ncccc3o2)cc(-c2cccc3[nH]ccc23)c1 |
| InChI | InChI=1S/C22H16N4O3/c1-28-22(27)25-15-11-13(16-4-2-5-18-17(16)7-9-23-18)10-14(12-15)21-26-20-19(29-21)6-3-8-24-20/h2-12,23H,1H3,(H,25,27) |
| InChIKey | JJRMCFYCKVRRTN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate?
The IUPAC name of methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate (CID 15603280) is methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate.
What is the SMILES notation for methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate?
The canonical SMILES for methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate is COC(=O)Nc1cc(-c2nc3ncccc3o2)cc(-c2cccc3[nH]ccc23)c1.
What is the InChIKey of methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate?
The InChIKey is JJRMCFYCKVRRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O3/c1-28-22(27)25-15-11-13(16-4-2-5-18-17(16)7-9-23-18)10-14(12-15)21-26-20-19(29-21)6-3-8-24-20/h2-12,23H,1H3,(H,25,27).
What are the key properties of methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate?
methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate has a molecular weight of 384.40 g/mol, XLogP of 5.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-(1H-indol-4-yl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate is sourced from PubChem (CID 15603280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).