About N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide
N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide (PubChem CID 15603614) has the molecular formula C23H17N3O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide |
| PubChem CID | 15603614 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2nc3ccccc3o2)cc(-c2cccc3[nH]ccc23)c1 |
| InChI | InChI=1S/C23H17N3O2/c1-14(27)25-17-12-15(18-5-4-7-20-19(18)9-10-24-20)11-16(13-17)23-26-21-6-2-3-8-22(21)28-23/h2-13,24H,1H3,(H,25,27) |
| InChIKey | DNYXYWMPEYVJEP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide?
The IUPAC name of N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide (CID 15603614) is N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide.
What is the SMILES notation for N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide?
The canonical SMILES for N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide is CC(=O)Nc1cc(-c2nc3ccccc3o2)cc(-c2cccc3[nH]ccc23)c1.
What is the InChIKey of N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide?
The InChIKey is DNYXYWMPEYVJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2/c1-14(27)25-17-12-15(18-5-4-7-20-19(18)9-10-24-20)11-16(13-17)23-26-21-6-2-3-8-22(21)28-23/h2-13,24H,1H3,(H,25,27).
What are the key properties of N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide?
N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide has a molecular weight of 367.41 g/mol, XLogP of 5.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-benzoxazol-2-yl)-5-(1H-indol-4-yl)phenyl]acetamide is sourced from PubChem (CID 15603614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).