C20H18N2O — CID 15604056
3-(2,3-dihydro-1H-inden-5-yl)-5-(pyridin-3-ylamino)phenol (PubChem CID 15604056) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)-5-(pyridin-3-ylamino)phenol.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)-5-(pyridin-3-ylamino)phenol |
|---|---|
| PubChem CID | 15604056 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)-5-(pyridin-3-ylamino)phenol |
| SMILES | Oc1cc(Nc2cccnc2)cc(-c2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C20H18N2O/c23-20-11-17(16-7-6-14-3-1-4-15(14)9-16)10-19(12-20)22-18-5-2-8-21-13-18/h2,5-13,22-23H,1,3-4H2 |
| InChIKey | QEJDAWXLJYQFFE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |