C26H42N8 — CID 15604290
2-N-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine (PubChem CID 15604290) has the molecular formula C26H42N8 and a molecular weight of 466.68 g/mol. Its IUPAC name is 2-N-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 15604290 |
| Molecular Formula | C26H42N8 |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 2-N-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2cc(N)nc(NCc3ccc(CNCCCNC4CCCCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C26H42N8/c1-33-14-16-34(17-15-33)25-18-24(27)31-26(32-25)30-20-22-10-8-21(9-11-22)19-28-12-5-13-29-23-6-3-2-4-7-23/h8-11,18,23,28-29H,2-7,12-17,19-20H2,1H3,(H3,27,30,31,32) |
| InChIKey | TYFGKHSNXGTUHE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|