About 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol
11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol (PubChem CID 15604542) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol.
Molecular Properties
| Compound Name | 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol |
| PubChem CID | 15604542 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol |
| SMILES | Cn1c2c(c3cc(O)ccc31)CCc1ncccc1-2 |
| InChI | InChI=1S/C16H14N2O/c1-18-15-7-4-10(19)9-13(15)11-5-6-14-12(16(11)18)3-2-8-17-14/h2-4,7-9,19H,5-6H2,1H3 |
| InChIKey | HFBFCDLZAKZWOX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol?
The IUPAC name of 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol (CID 15604542) is 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol.
What is the SMILES notation for 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol?
The canonical SMILES for 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol is Cn1c2c(c3cc(O)ccc31)CCc1ncccc1-2.
What is the InChIKey of 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol?
The InChIKey is HFBFCDLZAKZWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c1-18-15-7-4-10(19)9-13(15)11-5-6-14-12(16(11)18)3-2-8-17-14/h2-4,7-9,19H,5-6H2,1H3.
What are the key properties of 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol?
11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol has a molecular weight of 250.30 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-5,6-dihydropyrido[3,2-a]carbazol-8-ol is sourced from PubChem (CID 15604542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).