About 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide
1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide (PubChem CID 15604675) has the molecular formula C17H14N4O2
and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide.
Molecular Properties
| Compound Name | 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
| PubChem CID | 15604675 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc2cc3n(c2c1)CCNC3=O |
| InChI | InChI=1S/C17H14N4O2/c22-16(20-13-2-1-5-18-10-13)12-4-3-11-8-15-17(23)19-6-7-21(15)14(11)9-12/h1-5,8-10H,6-7H2,(H,19,23)(H,20,22) |
| InChIKey | YMFJIJWPXNXALF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide?
The IUPAC name of 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide (CID 15604675) is 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide.
What is the SMILES notation for 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide?
The canonical SMILES for 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide is O=C(Nc1cccnc1)c1ccc2cc3n(c2c1)CCNC3=O.
What is the InChIKey of 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide?
The InChIKey is YMFJIJWPXNXALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2/c22-16(20-13-2-1-5-18-10-13)12-4-3-11-8-15-17(23)19-6-7-21(15)14(11)9-12/h1-5,8-10H,6-7H2,(H,19,23)(H,20,22).
What are the key properties of 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide?
1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide has a molecular weight of 306.32 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-N-pyridin-3-yl-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide is sourced from PubChem (CID 15604675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).