C29H44O5 — CID 15604954
3-methylpentan-3-yl 2-[(1S)-1-[(4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate (PubChem CID 15604954) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is 3-methylpentan-3-yl 2-[(1S)-1-[(4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate.
| Compound Name | 3-methylpentan-3-yl 2-[(1S)-1-[(4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 15604954 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 3-methylpentan-3-yl 2-[(1S)-1-[(4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@H](C)OCC(=O)OC(C)(CC)CC)=CCC23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C29H44O5/c1-7-28(5,8-2)34-27(32)18-33-20(4)24-13-14-25-21(10-9-15-29(24,25)6)11-12-22-16-23(30)17-26(31)19(22)3/h11-13,20,23,25-26,30-31H,3,7-10,14-18H2,1-2,4-6H3/b21-11+,22-12-/t20-,23+,25?,26-,29+/m0/s1 |
| InChIKey | CUVAUYRJZSMEBI-QHRSDLPXSA-N |
| XLogP | 5.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|