C17H14N2O5 — CID 15605430
5-ethyl-3-phenacyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 15605430) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 5-ethyl-3-phenacyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-ethyl-3-phenacyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 15605430 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-ethyl-3-phenacyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCc1cc(=O)oc2[nH]c(=O)n(CC(=O)c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C17H14N2O5/c1-2-10-8-13(21)24-15-14(10)16(22)19(17(23)18-15)9-12(20)11-6-4-3-5-7-11/h3-8H,2,9H2,1H3,(H,18,23) |
| InChIKey | SPGJSTUCTCPABT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |