About methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate
methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate (PubChem CID 15605500) has the molecular formula C11H10N2O5
and a molecular weight of 250.21 g/mol. Its IUPAC name is methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate |
| PubChem CID | 15605500 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate |
| SMILES | CCc1cc(=O)oc2nc(C(=O)OC)[nH]c(=O)c12 |
| InChI | InChI=1S/C11H10N2O5/c1-3-5-4-6(14)18-10-7(5)9(15)12-8(13-10)11(16)17-2/h4H,3H2,1-2H3,(H,12,13,15) |
| InChIKey | MJLAQPZDJNEMAT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate?
The IUPAC name of methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate (CID 15605500) is methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate?
The canonical SMILES for methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate is CCc1cc(=O)oc2nc(C(=O)OC)[nH]c(=O)c12.
What is the InChIKey of methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate?
The InChIKey is MJLAQPZDJNEMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O5/c1-3-5-4-6(14)18-10-7(5)9(15)12-8(13-10)11(16)17-2/h4H,3H2,1-2H3,(H,12,13,15).
What are the key properties of methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate?
methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate has a molecular weight of 250.21 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-2-carboxylate is sourced from PubChem (CID 15605500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).