C19H30O3SSi — CID 15605758
[(2S,3R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxythiolan-2-yl]-phenylmethanone (PubChem CID 15605758) has the molecular formula C19H30O3SSi and a molecular weight of 366.60 g/mol. Its IUPAC name is [(2S,3R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxythiolan-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxythiolan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15605758 |
| Molecular Formula | C19H30O3SSi |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(2S,3R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-hydroxythiolan-2-yl]-phenylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1C[C@@H](O)[C@@H](C(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C19H30O3SSi/c1-19(2,3)24(4,5)22-12-11-15-13-16(20)18(23-15)17(21)14-9-7-6-8-10-14/h6-10,15-16,18,20H,11-13H2,1-5H3/t15-,16-,18+/m1/s1 |
| InChIKey | SRKYTNGJIPYWPI-NUJGCVRESA-N |
| XLogP | 4.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|