C23H42O3Si — CID 15605886
[(4E,6E,8E)-12-tri(propan-2-yl)silyloxydodeca-4,6,8-trienyl] acetate (PubChem CID 15605886) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(4E,6E,8E)-12-tri(propan-2-yl)silyloxydodeca-4,6,8-trienyl] acetate.
| Compound Name | [(4E,6E,8E)-12-tri(propan-2-yl)silyloxydodeca-4,6,8-trienyl] acetate |
|---|---|
| PubChem CID | 15605886 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(4E,6E,8E)-12-tri(propan-2-yl)silyloxydodeca-4,6,8-trienyl] acetate |
| SMILES | CC(=O)OCCC/C=C/C=C/C=C/CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42O3Si/c1-20(2)27(21(3)4,22(5)6)26-19-17-15-13-11-9-8-10-12-14-16-18-25-23(7)24/h8-13,20-22H,14-19H2,1-7H3/b9-8+,12-10+,13-11+ |
| InChIKey | AXHKTOWBZLRHGI-YIDQAKLOSA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|