C45H74O5Si3 — CID 15605931
(4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2E,4S,5S,7Z)-4,6,6-trimethyl-5,7-bis(triethylsilyloxy)nona-2,7-dien-2-yl]oxan-2-one (PubChem CID 15605931) has the molecular formula C45H74O5Si3 and a molecular weight of 779.34 g/mol. Its IUPAC name is (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2E,4S,5S,7Z)-4,6,6-trimethyl-5,7-bis(triethylsilyloxy)nona-2,7-dien-2-yl]oxan-2-one.
| Compound Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2E,4S,5S,7Z)-4,6,6-trimethyl-5,7-bis(triethylsilyloxy)nona-2,7-dien-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 15605931 |
| Molecular Formula | C45H74O5Si3 |
| Molecular Weight | 779.34 g/mol |
| Exact Mass | 778.48 |
| IUPAC Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2E,4S,5S,7Z)-4,6,6-trimethyl-5,7-bis(triethylsilyloxy)nona-2,7-dien-2-yl]oxan-2-one |
| SMILES | C/C=C(\O[Si](CC)(CC)CC)C(C)(C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)/C=C(\C)[C@@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C45H74O5Si3/c1-15-41(49-51(16-2,17-3)18-4)45(13,14)43(50-52(19-5,20-6)21-7)36(9)32-35(8)40-33-37(34-42(46)47-40)48-53(44(10,11)12,38-28-24-22-25-29-38)39-30-26-23-27-31-39/h15,22-32,36-37,40,43H,16-21,33-34H2,1-14H3/b35-32+,41-15-/t36-,37-,40-,43-/m0/s1 |
| InChIKey | ONGXESOZHTYSCU-QHYVXNLLSA-N |
| XLogP | 11.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.34 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|