About pyridazino[4,5-d]pyridazine
pyridazino[4,5-d]pyridazine (PubChem CID 15606212) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is pyridazino[4,5-d]pyridazine.
Molecular Properties
| Compound Name | pyridazino[4,5-d]pyridazine |
| PubChem CID | 15606212 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | pyridazino[4,5-d]pyridazine |
| SMILES | c1nncc2cnncc12 |
| InChI | InChI=1S/C6H4N4/c1-5-2-9-10-4-6(5)3-8-7-1/h1-4H |
| InChIKey | JBFWVXIWQBWEKM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridazino[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazino[4,5-d]pyridazine?
The IUPAC name of pyridazino[4,5-d]pyridazine (CID 15606212) is pyridazino[4,5-d]pyridazine.
What is the SMILES notation for pyridazino[4,5-d]pyridazine?
The canonical SMILES for pyridazino[4,5-d]pyridazine is c1nncc2cnncc12.
What is the InChIKey of pyridazino[4,5-d]pyridazine?
The InChIKey is JBFWVXIWQBWEKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c1-5-2-9-10-4-6(5)3-8-7-1/h1-4H.
What are the key properties of pyridazino[4,5-d]pyridazine?
pyridazino[4,5-d]pyridazine has a molecular weight of 132.13 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazino[4,5-d]pyridazine is sourced from PubChem (CID 15606212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).