C17H21FN2O2 — CID 15606318
tert-butyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate (PubChem CID 15606318) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is tert-butyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate.
| Compound Name | tert-butyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
|---|---|
| PubChem CID | 15606318 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C17H21FN2O2/c1-17(2,3)22-16(21)19-11-5-7-15-13(9-11)12-8-10(18)4-6-14(12)20-15/h4,6,8,11,20H,5,7,9H2,1-3H3,(H,19,21) |
| InChIKey | JEQGRSJGOIFHOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|