C4Br2Cl4F4 — CID 15606516
1,4-dibromo-2,2,3,3-tetrachloro-1,1,4,4-tetrafluorobutane (PubChem CID 15606516) has the molecular formula C4Br2Cl4F4 and a molecular weight of 425.66 g/mol. Its IUPAC name is 1,4-dibromo-2,2,3,3-tetrachloro-1,1,4,4-tetrafluorobutane.
| Compound Name | 1,4-dibromo-2,2,3,3-tetrachloro-1,1,4,4-tetrafluorobutane |
|---|---|
| PubChem CID | 15606516 |
| Molecular Formula | C4Br2Cl4F4 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 421.71 |
| IUPAC Name | 1,4-dibromo-2,2,3,3-tetrachloro-1,1,4,4-tetrafluorobutane |
| SMILES | FC(F)(Br)C(Cl)(Cl)C(Cl)(Cl)C(F)(F)Br |
| InChI | InChI=1S/C4Br2Cl4F4/c5-3(11,12)1(7,8)2(9,10)4(6,13)14 |
| InChIKey | PQVVWIGINPNVNL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|