About 2-azaniumylethylazanium dinitrate
2-azaniumylethylazanium dinitrate (PubChem CID 15606545) has the molecular formula C2H10N4O6
and a molecular weight of 186.12 g/mol. Its IUPAC name is 2-azaniumylethylazanium dinitrate.
Molecular Properties
| Compound Name | 2-azaniumylethylazanium dinitrate |
| PubChem CID | 15606545 |
| Molecular Formula | C2H10N4O6 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-azaniumylethylazanium dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[NH3+]CC[NH3+] |
| InChI | InChI=1S/C2H8N2.2NO3/c3-1-2-4;2*2-1(3)4/h1-4H2;;/q;2*-1/p+2 |
| InChIKey | PZFLLCJOKHGTEJ-UHFFFAOYSA-P |
| XLogP | -3.01 |
| TPSA | 187.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-azaniumylethylazanium dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethylazanium dinitrate?
The IUPAC name of 2-azaniumylethylazanium dinitrate (CID 15606545) is 2-azaniumylethylazanium dinitrate.
What is the SMILES notation for 2-azaniumylethylazanium dinitrate?
The canonical SMILES for 2-azaniumylethylazanium dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[NH3+]CC[NH3+].
What is the InChIKey of 2-azaniumylethylazanium dinitrate?
The InChIKey is PZFLLCJOKHGTEJ-UHFFFAOYSA-P. The full InChI is InChI=1S/C2H8N2.2NO3/c3-1-2-4;2*2-1(3)4/h1-4H2;;/q;2*-1/p+2.
What are the key properties of 2-azaniumylethylazanium dinitrate?
2-azaniumylethylazanium dinitrate has a molecular weight of 186.12 g/mol, XLogP of -3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethylazanium dinitrate is sourced from PubChem (CID 15606545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).