About 5-methyl-1,4-dioxane-2,3-diol
5-methyl-1,4-dioxane-2,3-diol (PubChem CID 15606718) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is 5-methyl-1,4-dioxane-2,3-diol.
Molecular Properties
| Compound Name | 5-methyl-1,4-dioxane-2,3-diol |
| PubChem CID | 15606718 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 5-methyl-1,4-dioxane-2,3-diol |
| SMILES | CC1COC(O)C(O)O1 |
| InChI | InChI=1S/C5H10O4/c1-3-2-8-4(6)5(7)9-3/h3-7H,2H2,1H3 |
| InChIKey | LFJVLQBHHRHLPF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1,4-dioxane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4-dioxane-2,3-diol?
The IUPAC name of 5-methyl-1,4-dioxane-2,3-diol (CID 15606718) is 5-methyl-1,4-dioxane-2,3-diol.
What is the SMILES notation for 5-methyl-1,4-dioxane-2,3-diol?
The canonical SMILES for 5-methyl-1,4-dioxane-2,3-diol is CC1COC(O)C(O)O1.
What is the InChIKey of 5-methyl-1,4-dioxane-2,3-diol?
The InChIKey is LFJVLQBHHRHLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-3-2-8-4(6)5(7)9-3/h3-7H,2H2,1H3.
What are the key properties of 5-methyl-1,4-dioxane-2,3-diol?
5-methyl-1,4-dioxane-2,3-diol has a molecular weight of 134.13 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4-dioxane-2,3-diol is sourced from PubChem (CID 15606718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).