About 2,2-bis(ethylamino)ethanol
2,2-bis(ethylamino)ethanol (PubChem CID 15606959) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is 2,2-bis(ethylamino)ethanol.
Molecular Properties
| Compound Name | 2,2-bis(ethylamino)ethanol |
| PubChem CID | 15606959 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 2,2-bis(ethylamino)ethanol |
| SMILES | CCNC(CO)NCC |
| InChI | InChI=1S/C6H16N2O/c1-3-7-6(5-9)8-4-2/h6-9H,3-5H2,1-2H3 |
| InChIKey | XIGPONCZHZOZGL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(ethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(ethylamino)ethanol?
The IUPAC name of 2,2-bis(ethylamino)ethanol (CID 15606959) is 2,2-bis(ethylamino)ethanol.
What is the SMILES notation for 2,2-bis(ethylamino)ethanol?
The canonical SMILES for 2,2-bis(ethylamino)ethanol is CCNC(CO)NCC.
What is the InChIKey of 2,2-bis(ethylamino)ethanol?
The InChIKey is XIGPONCZHZOZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O/c1-3-7-6(5-9)8-4-2/h6-9H,3-5H2,1-2H3.
What are the key properties of 2,2-bis(ethylamino)ethanol?
2,2-bis(ethylamino)ethanol has a molecular weight of 132.21 g/mol, XLogP of -0.48, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(ethylamino)ethanol is sourced from PubChem (CID 15606959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).