C24H15N3O9 — CID 15606988
4-[[4,6-bis(4-carboxyphenoxy)-1,3,5-triazin-2-yl]oxy]benzoic acid (PubChem CID 15606988) has the molecular formula C24H15N3O9 and a molecular weight of 489.40 g/mol. Its IUPAC name is 4-[[4,6-bis(4-carboxyphenoxy)-1,3,5-triazin-2-yl]oxy]benzoic acid.
| Compound Name | 4-[[4,6-bis(4-carboxyphenoxy)-1,3,5-triazin-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 15606988 |
| Molecular Formula | C24H15N3O9 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 4-[[4,6-bis(4-carboxyphenoxy)-1,3,5-triazin-2-yl]oxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2nc(Oc3ccc(C(=O)O)cc3)nc(Oc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C24H15N3O9/c28-19(29)13-1-7-16(8-2-13)34-22-25-23(35-17-9-3-14(4-10-17)20(30)31)27-24(26-22)36-18-11-5-15(6-12-18)21(32)33/h1-12H,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | PVNSFMMAPGZJAU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |