About (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide
(NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide (PubChem CID 15607280) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide.
Molecular Properties
| Compound Name | (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide |
| PubChem CID | 15607280 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide |
| SMILES | Cc1cc(C)n(C)/c(=N/S(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C13H16N4O2S/c1-9-8-10(2)17(3)13(15-9)16-20(18,19)12-6-4-11(14)5-7-12/h4-8H,14H2,1-3H3/b16-13+ |
| InChIKey | LFULTXIHDOVLRK-DTQAZKPQSA-N |
| XLogP | 0.91 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide?
The IUPAC name of (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide (CID 15607280) is (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide.
What is the SMILES notation for (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide?
The canonical SMILES for (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide is Cc1cc(C)n(C)/c(=N/S(=O)(=O)c2ccc(N)cc2)n1.
What is the InChIKey of (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide?
The InChIKey is LFULTXIHDOVLRK-DTQAZKPQSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-9-8-10(2)17(3)13(15-9)16-20(18,19)12-6-4-11(14)5-7-12/h4-8H,14H2,1-3H3/b16-13+.
What are the key properties of (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide?
(NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide has a molecular weight of 292.36 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-4-amino-N-(1,4,6-trimethylpyrimidin-2-ylidene)benzenesulfonamide is sourced from PubChem (CID 15607280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).