C13H15F6NO5 — CID 15607432
butyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate (PubChem CID 15607432) has the molecular formula C13H15F6NO5 and a molecular weight of 379.25 g/mol. Its IUPAC name is butyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate.
| Compound Name | butyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15607432 |
| Molecular Formula | C13H15F6NO5 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | butyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1CC(OC(=O)C(F)(F)F)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F6NO5/c1-2-3-4-24-9(21)8-5-7(25-11(23)13(17,18)19)6-20(8)10(22)12(14,15)16/h7-8H,2-6H2,1H3 |
| InChIKey | HHUVJOYDNNJSIT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|