About 1H-phenothiazine
1H-phenothiazine (PubChem CID 15607651) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 1H-phenothiazine.
Molecular Properties
| Compound Name | 1H-phenothiazine |
| PubChem CID | 15607651 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 1H-phenothiazine |
| SMILES | C1=CCC2=Nc3ccccc3SC2=C1 |
| InChI | InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-5,7-8H,6H2 |
| InChIKey | QWXDTDWOYQPERX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenothiazine?
The IUPAC name of 1H-phenothiazine (CID 15607651) is 1H-phenothiazine.
What is the SMILES notation for 1H-phenothiazine?
The canonical SMILES for 1H-phenothiazine is C1=CCC2=Nc3ccccc3SC2=C1.
What is the InChIKey of 1H-phenothiazine?
The InChIKey is QWXDTDWOYQPERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-5,7-8H,6H2.
What are the key properties of 1H-phenothiazine?
1H-phenothiazine has a molecular weight of 199.28 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenothiazine is sourced from PubChem (CID 15607651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).