C14H24O8 — CID 15608077
[(2S,3S,4S,5S)-2,5-diacetyloxy-1-deuterio-3,4-dimethoxyhexyl] acetate (PubChem CID 15608077) has the molecular formula C14H24O8 and a molecular weight of 321.34 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2,5-diacetyloxy-1-deuterio-3,4-dimethoxyhexyl] acetate.
| Compound Name | [(2S,3S,4S,5S)-2,5-diacetyloxy-1-deuterio-3,4-dimethoxyhexyl] acetate |
|---|---|
| PubChem CID | 15608077 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | [(2S,3S,4S,5S)-2,5-diacetyloxy-1-deuterio-3,4-dimethoxyhexyl] acetate |
| SMILES | [2H]C(OC(C)=O)[C@H](OC(C)=O)[C@H](OC)[C@@H](OC)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C14H24O8/c1-8(21-10(3)16)13(18-5)14(19-6)12(22-11(4)17)7-20-9(2)15/h8,12-14H,7H2,1-6H3/t8-,12-,13-,14-/m0/s1/i7D/t7?,8-,12-,13-,14- |
| InChIKey | QMLMVXJUHILWSZ-DKKHZOHASA-N |
| XLogP | 0.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|