About methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate
methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 15609932) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate.
Analyze methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate (CID 15609932) is methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate is COC(=O)[C@@]1(C)N=CO[C@H]1C.
What is the InChIKey of methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate?
The InChIKey is FFWVNFXQTMTMJC-FSPLSTOPSA-N. The full InChI is InChI=1S/C7H11NO3/c1-5-7(2,6(9)10-3)8-4-11-5/h4-5H,1-3H3/t5-,7-/m0/s1.
What are the key properties of methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate?
methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate has a molecular weight of 157.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5S)-4,5-dimethyl-5H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 15609932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).