C13H17N3O2S2 — CID 15610803
6-acetyl-2-hexylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 15610803) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 6-acetyl-2-hexylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-acetyl-2-hexylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 15610803 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 6-acetyl-2-hexylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCCSc1nn2c(=O)c(C(C)=O)cnc2s1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-3-4-5-6-7-19-13-15-16-11(18)10(9(2)17)8-14-12(16)20-13/h8H,3-7H2,1-2H3 |
| InChIKey | FFQWFNGOXRZUPX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|