C13H12Cl3F2N3O2 — CID 15611043
5-[chloro(difluoro)methyl]-2-(2,4-dichloro-5-propan-2-yloxyphenyl)-4-methyl-1,2,4-triazol-3-one (PubChem CID 15611043) has the molecular formula C13H12Cl3F2N3O2 and a molecular weight of 386.61 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-2-(2,4-dichloro-5-propan-2-yloxyphenyl)-4-methyl-1,2,4-triazol-3-one.
| Compound Name | 5-[chloro(difluoro)methyl]-2-(2,4-dichloro-5-propan-2-yloxyphenyl)-4-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 15611043 |
| Molecular Formula | C13H12Cl3F2N3O2 |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-2-(2,4-dichloro-5-propan-2-yloxyphenyl)-4-methyl-1,2,4-triazol-3-one |
| SMILES | CC(C)Oc1cc(-n2nc(C(F)(F)Cl)n(C)c2=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl3F2N3O2/c1-6(2)23-10-5-9(7(14)4-8(10)15)21-12(22)20(3)11(19-21)13(16,17)18/h4-6H,1-3H3 |
| InChIKey | ZEABLRNLXGKSPL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|