C6H4F5NO — CID 15613822
4,4,5,5,5-pentafluoro-2-methyl-3-oxopentanenitrile (PubChem CID 15613822) has the molecular formula C6H4F5NO and a molecular weight of 201.09 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-2-methyl-3-oxopentanenitrile.
| Compound Name | 4,4,5,5,5-pentafluoro-2-methyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 15613822 |
| Molecular Formula | C6H4F5NO |
| Molecular Weight | 201.09 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-2-methyl-3-oxopentanenitrile |
| SMILES | CC(C#N)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F5NO/c1-3(2-12)4(13)5(7,8)6(9,10)11/h3H,1H3 |
| InChIKey | OWVUFCVGOGXQNU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.09 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|