C11H7F5N2O — CID 15613906
5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-1,2-oxazol-3-amine (PubChem CID 15613906) has the molecular formula C11H7F5N2O and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-1,2-oxazol-3-amine.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 15613906 |
| Molecular Formula | C11H7F5N2O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C(F)(F)C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C11H7F5N2O/c12-10(13,11(14,15)16)8-7(9(17)18-19-8)6-4-2-1-3-5-6/h1-5H,(H2,17,18) |
| InChIKey | LWMAYRLPDIZXQE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|