C15H17NO3 — CID 15613973
methyl (2S)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 15613973) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl (2S)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15613973 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (2S)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-19-15(18)13-8-5-11-16(13)14(17)10-9-12-6-3-2-4-7-12/h2-4,6-7,9-10,13H,5,8,11H2,1H3/b10-9+/t13-/m0/s1 |
| InChIKey | DPIZRDMBBNDGAO-LXKVQUBZSA-N |
| XLogP | 1.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|