About (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate
(4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate (PubChem CID 15614377) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 15614377 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1=CC(O)C2CC1C2(C)C |
| InChI | InChI=1S/C15H24O3/c1-14(2,3)13(17)18-8-9-6-12(16)11-7-10(9)15(11,4)5/h6,10-12,16H,7-8H2,1-5H3 |
| InChIKey | GBMWZXYSDJCJFG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate (CID 15614377) is (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCC1=CC(O)C2CC1C2(C)C.
What is the InChIKey of (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate?
The InChIKey is GBMWZXYSDJCJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-14(2,3)13(17)18-8-9-6-12(16)11-7-10(9)15(11,4)5/h6,10-12,16H,7-8H2,1-5H3.
What are the key properties of (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate?
(4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate has a molecular weight of 252.35 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 15614377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).