C26H36O3S — CID 15614589
(2E,6E,8Z)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-ol (PubChem CID 15614589) has the molecular formula C26H36O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is (2E,6E,8Z)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-ol.
| Compound Name | (2E,6E,8Z)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-ol |
|---|---|
| PubChem CID | 15614589 |
| Molecular Formula | C26H36O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (2E,6E,8Z)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-ol |
| SMILES | CC1=C(/C(=C/C(C)=C/CC/C(C)=C/CO)S(=O)(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H36O3S/c1-20(16-18-27)11-9-12-21(2)19-24(25-22(3)13-10-17-26(25,4)5)30(28,29)23-14-7-6-8-15-23/h6-8,12,14-16,19,27H,9-11,13,17-18H2,1-5H3/b20-16+,21-12+,24-19- |
| InChIKey | JLXSOWZJFWJIHC-RHNOKDNDSA-N |
| XLogP | 6.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|