C12H11Cl5O3 — CID 15614627
[4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] acetate (PubChem CID 15614627) has the molecular formula C12H11Cl5O3 and a molecular weight of 380.48 g/mol. Its IUPAC name is [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] acetate.
| Compound Name | [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] acetate |
|---|---|
| PubChem CID | 15614627 |
| Molecular Formula | C12H11Cl5O3 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] acetate |
| SMILES | CC(=O)OCC(O)(CC(Cl)(Cl)Cl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl5O3/c1-7(18)20-6-11(19,5-12(15,16)17)8-2-9(13)4-10(14)3-8/h2-4,19H,5-6H2,1H3 |
| InChIKey | JDCKWUFOGYSPFJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|