C11H10Cl6O4S — CID 15614630
[4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] chloromethanesulfonate (PubChem CID 15614630) has the molecular formula C11H10Cl6O4S and a molecular weight of 450.98 g/mol. Its IUPAC name is [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] chloromethanesulfonate.
| Compound Name | [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] chloromethanesulfonate |
|---|---|
| PubChem CID | 15614630 |
| Molecular Formula | C11H10Cl6O4S |
| Molecular Weight | 450.98 g/mol |
| Exact Mass | 447.84 |
| IUPAC Name | [4,4,4-trichloro-2-(3,5-dichlorophenyl)-2-hydroxybutyl] chloromethanesulfonate |
| SMILES | O=S(=O)(CCl)OCC(O)(CC(Cl)(Cl)Cl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H10Cl6O4S/c12-6-22(19,20)21-5-10(18,4-11(15,16)17)7-1-8(13)3-9(14)2-7/h1-3,18H,4-6H2 |
| InChIKey | FBPQZWXZSQMPOR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|