About ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate
ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate (PubChem CID 15614978) has the molecular formula C24H28N2O5
and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate |
| PubChem CID | 15614978 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)[C@H](C)NC(=O)OCc1ccccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C24H28N2O5/c1-3-30-22(27)15-26(21-13-12-19-10-7-11-20(19)14-21)23(28)17(2)25-24(29)31-16-18-8-5-4-6-9-18/h4-6,8-9,12-14,17H,3,7,10-11,15-16H2,1-2H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | XMUMYDBIKOACGB-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate?
The IUPAC name of ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate (CID 15614978) is ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate.
What is the SMILES notation for ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate?
The canonical SMILES for ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate is CCOC(=O)CN(C(=O)[C@H](C)NC(=O)OCc1ccccc1)c1ccc2c(c1)CCC2.
What is the InChIKey of ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate?
The InChIKey is XMUMYDBIKOACGB-KRWDZBQOSA-N. The full InChI is InChI=1S/C24H28N2O5/c1-3-30-22(27)15-26(21-13-12-19-10-7-11-20(19)14-21)23(28)17(2)25-24(29)31-16-18-8-5-4-6-9-18/h4-6,8-9,12-14,17H,3,7,10-11,15-16H2,1-2H3,(H,25,29)/t17-/m0/s1.
What are the key properties of ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate?
ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate has a molecular weight of 424.50 g/mol, XLogP of 3.39, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate is sourced from PubChem (CID 15614978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).