About 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid
2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (PubChem CID 15614980) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| PubChem CID | 15614980 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N(CC(=O)O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H24N2O5/c1-15(23-22(28)29-14-16-6-3-2-4-7-16)21(27)24(13-20(25)26)19-11-10-17-8-5-9-18(17)12-19/h2-4,6-7,10-12,15H,5,8-9,13-14H2,1H3,(H,23,28)(H,25,26)/t15-/m0/s1 |
| InChIKey | OBOIQAMNDDAQBJ-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid?
The IUPAC name of 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (CID 15614980) is 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid.
What is the SMILES notation for 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid?
The canonical SMILES for 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid is C[C@H](NC(=O)OCc1ccccc1)C(=O)N(CC(=O)O)c1ccc2c(c1)CCC2.
What is the InChIKey of 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid?
The InChIKey is OBOIQAMNDDAQBJ-HNNXBMFYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-15(23-22(28)29-14-16-6-3-2-4-7-16)21(27)24(13-20(25)26)19-11-10-17-8-5-9-18(17)12-19/h2-4,6-7,10-12,15H,5,8-9,13-14H2,1H3,(H,23,28)(H,25,26)/t15-/m0/s1.
What are the key properties of 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid?
2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid has a molecular weight of 396.44 g/mol, XLogP of 2.91, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydro-1H-inden-5-yl-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid is sourced from PubChem (CID 15614980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).