C33H51N3O6 — CID 15615049
tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 15615049) has the molecular formula C33H51N3O6 and a molecular weight of 585.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15615049 |
| Molecular Formula | C33H51N3O6 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-1-cyclohexyl-3,4-dioxoheptan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCC(=O)C(=O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H51N3O6/c1-7-14-28(37)29(38)25(20-23-15-10-8-11-16-23)34-30(39)26(19-22(2)3)35-31(40)27(21-24-17-12-9-13-18-24)36-32(41)42-33(4,5)6/h9,12-13,17-18,22-23,25-27H,7-8,10-11,14-16,19-21H2,1-6H3,(H,34,39)(H,35,40)(H,36,41)/t25-,26-,27-/m0/s1 |
| InChIKey | IHADAHMXUIVHEE-QKDODKLFSA-N |
| XLogP | 5.05 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|