C7H10FN — CID 156158691
N-[(1E)-1-fluoro-4-methylpenta-1,3-dienyl]methanimine (PubChem CID 156158691) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-[(1E)-1-fluoro-4-methylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E)-1-fluoro-4-methylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 156158691 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N-[(1E)-1-fluoro-4-methylpenta-1,3-dienyl]methanimine |
| SMILES | CC(=C/C=C(\N=C)/F)C |
| InChI | InChI=1S/C7H10FN/c1-6(2)4-5-7(8)9-3/h4-5H,3H2,1-2H3/b7-5- |
| InChIKey | NPRMCSFHVIRDAU-ALCCZGGFSA-N |
| XLogP | 3.80 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 152 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|