About N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide
N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide (PubChem CID 15616047) has the molecular formula C12H11Cl2F3N2O2S
and a molecular weight of 375.20 g/mol. Its IUPAC name is N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide |
| PubChem CID | 15616047 |
| Molecular Formula | C12H11Cl2F3N2O2S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CC#N)S(=O)(=O)Cc1cc(C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl2F3N2O2S/c1-2-19(4-3-18)22(20,21)7-8-5-9(12(15,16)17)6-10(13)11(8)14/h5-6H,2,4,7H2,1H3 |
| InChIKey | OGFNWMRAZXOLEH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide?
The IUPAC name of N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide (CID 15616047) is N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide.
What is the SMILES notation for N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide?
The canonical SMILES for N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide is CCN(CC#N)S(=O)(=O)Cc1cc(C(F)(F)F)cc(Cl)c1Cl.
What is the InChIKey of N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide?
The InChIKey is OGFNWMRAZXOLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2F3N2O2S/c1-2-19(4-3-18)22(20,21)7-8-5-9(12(15,16)17)6-10(13)11(8)14/h5-6H,2,4,7H2,1H3.
What are the key properties of N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide?
N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide has a molecular weight of 375.20 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-1-[2,3-dichloro-5-(trifluoromethyl)phenyl]-N-ethylmethanesulfonamide is sourced from PubChem (CID 15616047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).